C11H15N3S — CID 2771995
1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropan-1-amine (PubChem CID 2771995) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropan-1-amine.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 2771995 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropan-1-amine |
| SMILES | CSCCC(N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H15N3S/c1-15-7-6-8(12)11-13-9-4-2-3-5-10(9)14-11/h2-5,8H,6-7,12H2,1H3,(H,13,14) |
| InChIKey | WWNOVKZOKFLYAF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |