C11H17Cl2N3 — CID 112756298
(1R)-1-(1H-benzimidazol-2-yl)-2-methylpropan-1-amine;dihydrochloride (PubChem CID 112756298) has the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. Its IUPAC name is (1R)-1-(1H-benzimidazol-2-yl)-2-methylpropan-1-amine;dihydrochloride.
| Compound Name | (1R)-1-(1H-benzimidazol-2-yl)-2-methylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 112756298 |
| Molecular Formula | C11H17Cl2N3 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (1R)-1-(1H-benzimidazol-2-yl)-2-methylpropan-1-amine;dihydrochloride |
| SMILES | CC(C)[C@@H](N)c1nc2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C11H15N3.2ClH/c1-7(2)10(12)11-13-8-5-3-4-6-9(8)14-11;;/h3-7,10H,12H2,1-2H3,(H,13,14);2*1H/t10-;;/m1../s1 |
| InChIKey | QNKCDXRSBZHZKZ-YQFADDPSSA-N |
| XLogP | 3.06 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |