C9H6F4N2 — CID 683204
2-[(1R)-1,2,2,2-tetrafluoroethyl]-1H-benzimidazole (PubChem CID 683204) has the molecular formula C9H6F4N2 and a molecular weight of 218.15 g/mol. Its IUPAC name is 2-[(1R)-1,2,2,2-tetrafluoroethyl]-1H-benzimidazole.
| Compound Name | 2-[(1R)-1,2,2,2-tetrafluoroethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 683204 |
| Molecular Formula | C9H6F4N2 |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-[(1R)-1,2,2,2-tetrafluoroethyl]-1H-benzimidazole |
| SMILES | F[C@H](c1nc2ccccc2[nH]1)C(F)(F)F |
| InChI | InChI=1S/C9H6F4N2/c10-7(9(11,12)13)8-14-5-3-1-2-4-6(5)15-8/h1-4,7H,(H,14,15)/t7-/m1/s1 |
| InChIKey | QOXFGGCVUDFHNX-SSDOTTSWSA-N |
| XLogP | 3.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |