C10H7F3N2O2 — CID 175542430
3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-quinoxalin-2-one (PubChem CID 175542430) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-quinoxalin-2-one.
| Compound Name | 3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 175542430 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1C(O)C(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)8(16)7-9(17)15-6-4-2-1-3-5(6)14-7/h1-4,8,16H,(H,15,17) |
| InChIKey | HNEQXVPATPNDEQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |