C15H17ClF2N2O — CID 71653952
3-(7-chloro-1,1-difluoroheptyl)-1H-quinoxalin-2-one (PubChem CID 71653952) has the molecular formula C15H17ClF2N2O and a molecular weight of 314.76 g/mol. Its IUPAC name is 3-(7-chloro-1,1-difluoroheptyl)-1H-quinoxalin-2-one.
| Compound Name | 3-(7-chloro-1,1-difluoroheptyl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 71653952 |
| Molecular Formula | C15H17ClF2N2O |
| Molecular Weight | 314.76 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-(7-chloro-1,1-difluoroheptyl)-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1C(F)(F)CCCCCCCl |
| InChI | InChI=1S/C15H17ClF2N2O/c16-10-6-2-1-5-9-15(17,18)13-14(21)20-12-8-4-3-7-11(12)19-13/h3-4,7-8H,1-2,5-6,9-10H2,(H,20,21) |
| InChIKey | CWYIWCZFYCTKNU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|