C19H24F2N2O — CID 122576122
3-[1,1-difluoro-5-[(1R)-2-methylcyclopentyl]pentyl]-1H-quinoxalin-2-one (PubChem CID 122576122) has the molecular formula C19H24F2N2O and a molecular weight of 334.41 g/mol. Its IUPAC name is 3-[1,1-difluoro-5-[(1R)-2-methylcyclopentyl]pentyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[1,1-difluoro-5-[(1R)-2-methylcyclopentyl]pentyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 122576122 |
| Molecular Formula | C19H24F2N2O |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-[1,1-difluoro-5-[(1R)-2-methylcyclopentyl]pentyl]-1H-quinoxalin-2-one |
| SMILES | CC1CCC[C@H]1CCCCC(F)(F)c1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C19H24F2N2O/c1-13-7-6-9-14(13)8-4-5-12-19(20,21)17-18(24)23-16-11-3-2-10-15(16)22-17/h2-3,10-11,13-14H,4-9,12H2,1H3,(H,23,24)/t13?,14-/m1/s1 |
| InChIKey | BQRREPFHIWSSSN-ARLHGKGLSA-N |
| XLogP | 5.01 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|