C14H16N2O2 — CID 702935
3-(2-hydroxy-3,3-dimethylbut-1-enyl)-1H-quinoxalin-2-one (PubChem CID 702935) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-(2-hydroxy-3,3-dimethylbut-1-enyl)-1H-quinoxalin-2-one.
| Compound Name | 3-(2-hydroxy-3,3-dimethylbut-1-enyl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 702935 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-(2-hydroxy-3,3-dimethylbut-1-enyl)-1H-quinoxalin-2-one |
| SMILES | CC(C)(C)C(O)=Cc1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C14H16N2O2/c1-14(2,3)12(17)8-11-13(18)16-10-7-5-4-6-9(10)15-11/h4-8,17H,1-3H3,(H,16,18) |
| InChIKey | NJRLTELYDXFPPE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|