C16H12N2O3 — CID 135713003
3-[(Z)-2-hydroxy-2-(4-hydroxyphenyl)ethenyl]-1H-quinoxalin-2-one (PubChem CID 135713003) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[(Z)-2-hydroxy-2-(4-hydroxyphenyl)ethenyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(Z)-2-hydroxy-2-(4-hydroxyphenyl)ethenyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135713003 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-[(Z)-2-hydroxy-2-(4-hydroxyphenyl)ethenyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1/C=C(\O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H12N2O3/c19-11-7-5-10(6-8-11)15(20)9-14-16(21)18-13-4-2-1-3-12(13)17-14/h1-9,19-20H,(H,18,21)/b15-9- |
| InChIKey | CRXDHNOZGYQSAL-DHDCSXOGSA-N |
| XLogP | 2.68 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|