C23H17N3O6 — CID 135541452
3,4,5-trihydroxy-N-[3-[(E)-1-hydroxy-2-(3-oxo-4H-quinoxalin-2-yl)ethenyl]phenyl]benzamide (PubChem CID 135541452) has the molecular formula C23H17N3O6 and a molecular weight of 431.40 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[3-[(E)-1-hydroxy-2-(3-oxo-4H-quinoxalin-2-yl)ethenyl]phenyl]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[3-[(E)-1-hydroxy-2-(3-oxo-4H-quinoxalin-2-yl)ethenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 135541452 |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 3,4,5-trihydroxy-N-[3-[(E)-1-hydroxy-2-(3-oxo-4H-quinoxalin-2-yl)ethenyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(/C(O)=C\c2nc3ccccc3[nH]c2=O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C23H17N3O6/c27-18(11-17-23(32)26-16-7-2-1-6-15(16)25-17)12-4-3-5-14(8-12)24-22(31)13-9-19(28)21(30)20(29)10-13/h1-11,27-30H,(H,24,31)(H,26,32)/b18-11+ |
| InChIKey | RINRUTWJKCEKID-WOJGMQOQSA-N |
| XLogP | 3.35 |
| TPSA | 155.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|