C11H8N2O3 — CID 2554781
(Z)-3-(3-oxo-4H-quinoxalin-2-yl)prop-2-enoic acid (PubChem CID 2554781) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is (Z)-3-(3-oxo-4H-quinoxalin-2-yl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3-oxo-4H-quinoxalin-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 2554781 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (Z)-3-(3-oxo-4H-quinoxalin-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C\c1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C11H8N2O3/c14-10(15)6-5-9-11(16)13-8-4-2-1-3-7(8)12-9/h1-6H,(H,13,16)(H,14,15)/b6-5- |
| InChIKey | HMYGHKLPRIZCFM-WAYWQWQTSA-N |
| XLogP | 1.02 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|