C16H13N3O2 — CID 135508597
3-[(Z)-2-hydroxy-2-(4-methylphenyl)ethenyl]-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 135508597) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[(Z)-2-hydroxy-2-(4-methylphenyl)ethenyl]-1H-pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 3-[(Z)-2-hydroxy-2-(4-methylphenyl)ethenyl]-1H-pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 135508597 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[(Z)-2-hydroxy-2-(4-methylphenyl)ethenyl]-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | Cc1ccc(/C(O)=C/c2nc3ncccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H13N3O2/c1-10-4-6-11(7-5-10)14(20)9-13-16(21)19-12-3-2-8-17-15(12)18-13/h2-9,20H,1H3,(H,19,21)/b14-9- |
| InChIKey | KAZAMGXIEWUMTN-ZROIWOOFSA-N |
| XLogP | 2.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|