C7H9N3O4S — CID 172837895
2-methyl-1H-imidazo[4,5-b]pyridine;sulfuric acid (PubChem CID 172837895) has the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-methyl-1H-imidazo[4,5-b]pyridine;sulfuric acid.
| Compound Name | 2-methyl-1H-imidazo[4,5-b]pyridine;sulfuric acid |
|---|---|
| PubChem CID | 172837895 |
| Molecular Formula | C7H9N3O4S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-methyl-1H-imidazo[4,5-b]pyridine;sulfuric acid |
| SMILES | Cc1nc2ncccc2[nH]1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H7N3.H2O4S/c1-5-9-6-3-2-4-8-7(6)10-5;1-5(2,3)4/h2-4H,1H3,(H,8,9,10);(H2,1,2,3,4) |
| InChIKey | WKDCBZBDMBAQOJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|