C12H17N3O2 — CID 91082689
ethane;ethyl 2-(1H-imidazo[4,5-b]pyridin-2-yl)acetate (PubChem CID 91082689) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is ethane;ethyl 2-(1H-imidazo[4,5-b]pyridin-2-yl)acetate.
| Compound Name | ethane;ethyl 2-(1H-imidazo[4,5-b]pyridin-2-yl)acetate |
|---|---|
| PubChem CID | 91082689 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | ethane;ethyl 2-(1H-imidazo[4,5-b]pyridin-2-yl)acetate |
| SMILES | CC.CCOC(=O)Cc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C10H11N3O2.C2H6/c1-2-15-9(14)6-8-12-7-4-3-5-11-10(7)13-8;1-2/h3-5H,2,6H2,1H3,(H,11,12,13);1-2H3 |
| InChIKey | BUNDTHQOTCONHG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |