C11H15N3O3S — CID 141123790
butyl 1H-imidazo[4,5-b]pyridin-2-ylmethanesulfonate (PubChem CID 141123790) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is butyl 1H-imidazo[4,5-b]pyridin-2-ylmethanesulfonate.
| Compound Name | butyl 1H-imidazo[4,5-b]pyridin-2-ylmethanesulfonate |
|---|---|
| PubChem CID | 141123790 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | butyl 1H-imidazo[4,5-b]pyridin-2-ylmethanesulfonate |
| SMILES | CCCCOS(=O)(=O)Cc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C11H15N3O3S/c1-2-3-7-17-18(15,16)8-10-13-9-5-4-6-12-11(9)14-10/h4-6H,2-3,7-8H2,1H3,(H,12,13,14) |
| InChIKey | KIPVJUCXPGILGH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|