C11H16N4 — CID 62827619
N-ethyl-1-(1H-imidazo[4,5-b]pyridin-2-yl)propan-2-amine (PubChem CID 62827619) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is N-ethyl-1-(1H-imidazo[4,5-b]pyridin-2-yl)propan-2-amine.
| Compound Name | N-ethyl-1-(1H-imidazo[4,5-b]pyridin-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 62827619 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-ethyl-1-(1H-imidazo[4,5-b]pyridin-2-yl)propan-2-amine |
| SMILES | CCNC(C)Cc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C11H16N4/c1-3-12-8(2)7-10-14-9-5-4-6-13-11(9)15-10/h4-6,8,12H,3,7H2,1-2H3,(H,13,14,15) |
| InChIKey | IHBMPUFUKUFHPH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |