C25H21N3P+ — CID 86059470
1H-imidazo[4,5-b]pyridin-2-ylmethyl(triphenyl)phosphanium (PubChem CID 86059470) has the molecular formula C25H21N3P+ and a molecular weight of 394.44 g/mol. Its IUPAC name is 1H-imidazo[4,5-b]pyridin-2-ylmethyl(triphenyl)phosphanium.
| Compound Name | 1H-imidazo[4,5-b]pyridin-2-ylmethyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 86059470 |
| Molecular Formula | C25H21N3P+ |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1H-imidazo[4,5-b]pyridin-2-ylmethyl(triphenyl)phosphanium |
| SMILES | c1ccc([P+](Cc2nc3ncccc3[nH]2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3P/c1-4-11-20(12-5-1)29(21-13-6-2-7-14-21,22-15-8-3-9-16-22)19-24-27-23-17-10-18-26-25(23)28-24/h1-18H,19H2,(H,26,27,28)/q+1 |
| InChIKey | UCIJCHRHYHSJLR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|