C16H12N4S — CID 139068907
2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole (PubChem CID 139068907) has the molecular formula C16H12N4S and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 139068907 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole |
| SMILES | c1ccc(-c2csc(Cc3nc4ncccc4[nH]3)n2)cc1 |
| InChI | InChI=1S/C16H12N4S/c1-2-5-11(6-3-1)13-10-21-15(19-13)9-14-18-12-7-4-8-17-16(12)20-14/h1-8,10H,9H2,(H,17,18,20) |
| InChIKey | GWAWAHUMXBRPIW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |