About 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole
2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole (PubChem CID 139068907) has the molecular formula C16H12N4S
and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole |
| PubChem CID | 139068907 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole |
| SMILES | c1ccc(-c2csc(Cc3nc4ncccc4[nH]3)n2)cc1 |
| InChI | InChI=1S/C16H12N4S/c1-2-5-11(6-3-1)13-10-21-15(19-13)9-14-18-12-7-4-8-17-16(12)20-14/h1-8,10H,9H2,(H,17,18,20) |
| InChIKey | GWAWAHUMXBRPIW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole?
The IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole (CID 139068907) is 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole.
What is the SMILES notation for 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole?
The canonical SMILES for 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole is c1ccc(-c2csc(Cc3nc4ncccc4[nH]3)n2)cc1.
What is the InChIKey of 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole?
The InChIKey is GWAWAHUMXBRPIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4S/c1-2-5-11(6-3-1)13-10-21-15(19-13)9-14-18-12-7-4-8-17-16(12)20-14/h1-8,10H,9H2,(H,17,18,20).
What are the key properties of 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole?
2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole has a molecular weight of 292.37 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-4-phenyl-1,3-thiazole is sourced from PubChem (CID 139068907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).