C19H16N2S — CID 174374982
2-[2-(1H-indol-3-yl)ethyl]-4-phenyl-1,3-thiazole (PubChem CID 174374982) has the molecular formula C19H16N2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethyl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[2-(1H-indol-3-yl)ethyl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 174374982 |
| Molecular Formula | C19H16N2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethyl]-4-phenyl-1,3-thiazole |
| SMILES | c1ccc(-c2csc(CCc3c[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C19H16N2S/c1-2-6-14(7-3-1)18-13-22-19(21-18)11-10-15-12-20-17-9-5-4-8-16(15)17/h1-9,12-13,20H,10-11H2 |
| InChIKey | PJBXGCNXNSXIJP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |