C18H14N2O2S — CID 22332875
4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 22332875) has the molecular formula C18H14N2O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | 4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 22332875 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2csc(Cc3c[nH]c4ccccc34)n2)cc1O |
| InChI | InChI=1S/C18H14N2O2S/c21-16-6-5-11(7-17(16)22)15-10-23-18(20-15)8-12-9-19-14-4-2-1-3-13(12)14/h1-7,9-10,19,21-22H,8H2 |
| InChIKey | TXDXXYGZUAMHTF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|