C16H17N3O2S — CID 151111117
N-hydroxy-4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]butanamide (PubChem CID 151111117) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-hydroxy-4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]butanamide.
| Compound Name | N-hydroxy-4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]butanamide |
|---|---|
| PubChem CID | 151111117 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-hydroxy-4-[2-(1H-indol-3-ylmethyl)-1,3-thiazol-4-yl]butanamide |
| SMILES | O=C(CCCc1csc(Cc2c[nH]c3ccccc23)n1)NO |
| InChI | InChI=1S/C16H17N3O2S/c20-15(19-21)7-3-4-12-10-22-16(18-12)8-11-9-17-14-6-2-1-5-13(11)14/h1-2,5-6,9-10,17,21H,3-4,7-8H2,(H,19,20) |
| InChIKey | MQDMIIJMYXDQJD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|