C16H17N3OS — CID 104579103
4-(1H-indol-3-yl)-N-(1,3-thiazol-5-ylmethyl)butanamide (PubChem CID 104579103) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-(1,3-thiazol-5-ylmethyl)butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-(1,3-thiazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 104579103 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-(1,3-thiazol-5-ylmethyl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCc1cncs1 |
| InChI | InChI=1S/C16H17N3OS/c20-16(19-10-13-9-17-11-21-13)7-3-4-12-8-18-15-6-2-1-5-14(12)15/h1-2,5-6,8-9,11,18H,3-4,7,10H2,(H,19,20) |
| InChIKey | LVSLRGSEYQUFNT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |