C21H19N3OS — CID 110406906
N-(1H-indol-3-ylmethyl)-3-(2-phenyl-1,3-thiazol-4-yl)propanamide (PubChem CID 110406906) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is N-(1H-indol-3-ylmethyl)-3-(2-phenyl-1,3-thiazol-4-yl)propanamide.
| Compound Name | N-(1H-indol-3-ylmethyl)-3-(2-phenyl-1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110406906 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(1H-indol-3-ylmethyl)-3-(2-phenyl-1,3-thiazol-4-yl)propanamide |
| SMILES | O=C(CCc1csc(-c2ccccc2)n1)NCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19N3OS/c25-20(23-13-16-12-22-19-9-5-4-8-18(16)19)11-10-17-14-26-21(24-17)15-6-2-1-3-7-15/h1-9,12,14,22H,10-11,13H2,(H,23,25) |
| InChIKey | JGTCBJQIBFMUKM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |