C20H15FN2O2S — CID 8892468
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate (PubChem CID 8892468) has the molecular formula C20H15FN2O2S and a molecular weight of 366.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 8892468 |
| Molecular Formula | C20H15FN2O2S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H15FN2O2S/c21-15-7-5-13(6-8-15)20-23-16(12-26-20)11-25-19(24)9-14-10-22-18-4-2-1-3-17(14)18/h1-8,10,12,22H,9,11H2 |
| InChIKey | AMEOIIHVSSTQMV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |