C22H20N2O4S — CID 7666371
[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate (PubChem CID 7666371) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7666371 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1H-indol-3-yl)acetate |
| SMILES | COc1cccc(-c2nc(COC(=O)Cc3c[nH]c4ccccc34)cs2)c1OC |
| InChI | InChI=1S/C22H20N2O4S/c1-26-19-9-5-7-17(21(19)27-2)22-24-15(13-29-22)12-28-20(25)10-14-11-23-18-8-4-3-6-16(14)18/h3-9,11,13,23H,10,12H2,1-2H3 |
| InChIKey | YYTKPSUTWWOOBK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |