C18H25N3OS — CID 119681392
7-amino-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]heptanamide (PubChem CID 119681392) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 7-amino-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]heptanamide.
| Compound Name | 7-amino-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]heptanamide |
|---|---|
| PubChem CID | 119681392 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 7-amino-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]heptanamide |
| SMILES | NCCCCCCC(=O)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H25N3OS/c19-12-7-2-1-6-10-17(22)20-13-11-16-14-23-18(21-16)15-8-4-3-5-9-15/h3-5,8-9,14H,1-2,6-7,10-13,19H2,(H,20,22) |
| InChIKey | BVJFNWMPHWPPKY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|