C18H18N2O2S — CID 71973739
3-(furan-2-yl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]propanamide (PubChem CID 71973739) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]propanamide.
| Compound Name | 3-(furan-2-yl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 71973739 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-(furan-2-yl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]propanamide |
| SMILES | O=C(CCc1ccco1)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N2O2S/c21-17(9-8-16-7-4-12-22-16)19-11-10-15-13-23-18(20-15)14-5-2-1-3-6-14/h1-7,12-13H,8-11H2,(H,19,21) |
| InChIKey | WPBNXMDUKSBYBC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |