C16H12FNOS — CID 83130460
3-fluoro-4-[(4-phenyl-1,3-thiazol-2-yl)methyl]phenol (PubChem CID 83130460) has the molecular formula C16H12FNOS and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-fluoro-4-[(4-phenyl-1,3-thiazol-2-yl)methyl]phenol.
| Compound Name | 3-fluoro-4-[(4-phenyl-1,3-thiazol-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 83130460 |
| Molecular Formula | C16H12FNOS |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-fluoro-4-[(4-phenyl-1,3-thiazol-2-yl)methyl]phenol |
| SMILES | Oc1ccc(Cc2nc(-c3ccccc3)cs2)c(F)c1 |
| InChI | InChI=1S/C16H12FNOS/c17-14-9-13(19)7-6-12(14)8-16-18-15(10-20-16)11-4-2-1-3-5-11/h1-7,9-10,19H,8H2 |
| InChIKey | WAYQMJKTKHOZKZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |