C13H11N3O2 — CID 67282201
4-hydroxy-2-(1H-indol-3-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 67282201) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-hydroxy-2-(1H-indol-3-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-(1H-indol-3-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 67282201 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-hydroxy-2-(1H-indol-3-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(O)nc(Cc2c[nH]c3ccccc23)[nH]1 |
| InChI | InChI=1S/C13H11N3O2/c17-12-6-13(18)16-11(15-12)5-8-7-14-10-4-2-1-3-9(8)10/h1-4,6-7,14H,5H2,(H2,15,16,17,18) |
| InChIKey | PYZSZPWUBDWJBM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |