C15H11BrN2S — CID 79817242
2-[(6-bromo-2-pyridinyl)methyl]-4-phenyl-1,3-thiazole (PubChem CID 79817242) has the molecular formula C15H11BrN2S and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-[(6-bromo-2-pyridinyl)methyl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[(6-bromo-2-pyridinyl)methyl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 79817242 |
| Molecular Formula | C15H11BrN2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-[(6-bromo-2-pyridinyl)methyl]-4-phenyl-1,3-thiazole |
| SMILES | Brc1cccc(Cc2nc(-c3ccccc3)cs2)n1 |
| InChI | InChI=1S/C15H11BrN2S/c16-14-8-4-7-12(17-14)9-15-18-13(10-19-15)11-5-2-1-3-6-11/h1-8,10H,9H2 |
| InChIKey | XOPCVLPUGKGDMY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|