C12H18N4 — CID 14855677
4-(1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylbutan-1-amine (PubChem CID 14855677) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 14855677 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-(1H-imidazo[4,5-b]pyridin-2-yl)-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C12H18N4/c1-16(2)9-4-3-7-11-14-10-6-5-8-13-12(10)15-11/h5-6,8H,3-4,7,9H2,1-2H3,(H,13,14,15) |
| InChIKey | WWNDPUFANYXIOC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|