C19H18N2O2 — CID 135637753
3-[(E)-2-(2,5-dimethylphenyl)-2-hydroxyethenyl]-7-methyl-1H-quinoxalin-2-one (PubChem CID 135637753) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-[(E)-2-(2,5-dimethylphenyl)-2-hydroxyethenyl]-7-methyl-1H-quinoxalin-2-one.
| Compound Name | 3-[(E)-2-(2,5-dimethylphenyl)-2-hydroxyethenyl]-7-methyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135637753 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-[(E)-2-(2,5-dimethylphenyl)-2-hydroxyethenyl]-7-methyl-1H-quinoxalin-2-one |
| SMILES | Cc1ccc(C)c(/C(O)=C\c2nc3ccc(C)cc3[nH]c2=O)c1 |
| InChI | InChI=1S/C19H18N2O2/c1-11-4-6-13(3)14(8-11)18(22)10-17-19(23)21-16-9-12(2)5-7-15(16)20-17/h4-10,22H,1-3H3,(H,21,23)/b18-10+ |
| InChIKey | JJYPEAIDNQDMNP-VCHYOVAHSA-N |
| XLogP | 3.90 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|