C28H26N2O2 — CID 135477989
(Z)-1-(2,4-dimethylphenyl)-2-[3-[(Z)-2-(2,4-dimethylphenyl)-2-hydroxyethenyl]quinoxalin-2-yl]ethenol (PubChem CID 135477989) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is (Z)-1-(2,4-dimethylphenyl)-2-[3-[(Z)-2-(2,4-dimethylphenyl)-2-hydroxyethenyl]quinoxalin-2-yl]ethenol.
| Compound Name | (Z)-1-(2,4-dimethylphenyl)-2-[3-[(Z)-2-(2,4-dimethylphenyl)-2-hydroxyethenyl]quinoxalin-2-yl]ethenol |
|---|---|
| PubChem CID | 135477989 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (Z)-1-(2,4-dimethylphenyl)-2-[3-[(Z)-2-(2,4-dimethylphenyl)-2-hydroxyethenyl]quinoxalin-2-yl]ethenol |
| SMILES | Cc1ccc(/C(O)=C/c2nc3ccccc3nc2/C=C(\O)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C28H26N2O2/c1-17-9-11-21(19(3)13-17)27(31)15-25-26(30-24-8-6-5-7-23(24)29-25)16-28(32)22-12-10-18(2)14-20(22)4/h5-16,31-32H,1-4H3/b27-15-,28-16- |
| InChIKey | LZAHGBVIURBLMI-USYBVIFISA-N |
| XLogP | 6.98 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_66_C(2)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|