C32H34B2N4O4 — CID 139125208
quinoxalino[2,3-b]quinoxaline;bis((2,4,6-trimethylphenyl)boronic acid) (PubChem CID 139125208) has the molecular formula C32H34B2N4O4 and a molecular weight of 560.27 g/mol. Its IUPAC name is quinoxalino[2,3-b]quinoxaline;bis((2,4,6-trimethylphenyl)boronic acid).
| Compound Name | quinoxalino[2,3-b]quinoxaline;bis((2,4,6-trimethylphenyl)boronic acid) |
|---|---|
| PubChem CID | 139125208 |
| Molecular Formula | C32H34B2N4O4 |
| Molecular Weight | 560.27 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | quinoxalino[2,3-b]quinoxaline;bis((2,4,6-trimethylphenyl)boronic acid) |
| SMILES | Cc1cc(C)c(B(O)O)c(C)c1.Cc1cc(C)c(B(O)O)c(C)c1.c1ccc2nc3nc4ccccc4nc3nc2c1 |
| InChI | InChI=1S/C14H8N4.2C9H13BO2/c1-2-6-10-9(5-1)15-13-14(16-10)18-12-8-4-3-7-11(12)17-13;2*1-6-4-7(2)9(10(11)12)8(3)5-6/h1-8H;2*4-5,11-12H,1-3H3 |
| InChIKey | XFJCAXRGDGYQMW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|