(3,5-dimethyl-2,6-diphenylphenyl)boronic acid

C20H19BO2 — CID 178131684

IUPAC(3,5-dimethyl-2,6-diphenylphenyl)boronic acid
SMILESCc1cc(C)c(-c2ccccc2)c(B(O)O)c1-c1ccccc1
InChIInChI=1S/C20H19BO2/c1-14-13-15(2)19(17-11-7-4-8-12-17)20(21(22)23)18(14)16-9-5-3-6-10-16/h3-13,22-23H,1-2H3
InChIKeyJZGCREIQQABDIF-UHFFFAOYSA-N
MW302.18 g/mol
LogP3.32
Rot. Bonds3

About (3,5-dimethyl-2,6-diphenylphenyl)boronic acid

(3,5-dimethyl-2,6-diphenylphenyl)boronic acid (PubChem CID 178131684) has the molecular formula C20H19BO2 and a molecular weight of 302.18 g/mol. Its IUPAC name is (3,5-dimethyl-2,6-diphenylphenyl)boronic acid.

Molecular Properties

Compound Name(3,5-dimethyl-2,6-diphenylphenyl)boronic acid
PubChem CID178131684
Molecular FormulaC20H19BO2
Molecular Weight302.18 g/mol
Exact Mass302.15
IUPAC Name(3,5-dimethyl-2,6-diphenylphenyl)boronic acid
SMILESCc1cc(C)c(-c2ccccc2)c(B(O)O)c1-c1ccccc1
InChIInChI=1S/C20H19BO2/c1-14-13-15(2)19(17-11-7-4-8-12-17)20(21(22)23)18(14)16-9-5-3-6-10-16/h3-13,22-23H,1-2H3
InChIKeyJZGCREIQQABDIF-UHFFFAOYSA-N
XLogP3.32
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.18
LogP ≤ 53.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3,5-dimethyl-2,6-diphenylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dimethyl-2,6-diphenylphenyl)boronic acid?
The IUPAC name of (3,5-dimethyl-2,6-diphenylphenyl)boronic acid (CID 178131684) is (3,5-dimethyl-2,6-diphenylphenyl)boronic acid.
What is the SMILES notation for (3,5-dimethyl-2,6-diphenylphenyl)boronic acid?
The canonical SMILES for (3,5-dimethyl-2,6-diphenylphenyl)boronic acid is Cc1cc(C)c(-c2ccccc2)c(B(O)O)c1-c1ccccc1.
What is the InChIKey of (3,5-dimethyl-2,6-diphenylphenyl)boronic acid?
The InChIKey is JZGCREIQQABDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BO2/c1-14-13-15(2)19(17-11-7-4-8-12-17)20(21(22)23)18(14)16-9-5-3-6-10-16/h3-13,22-23H,1-2H3.
What are the key properties of (3,5-dimethyl-2,6-diphenylphenyl)boronic acid?
(3,5-dimethyl-2,6-diphenylphenyl)boronic acid has a molecular weight of 302.18 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-2,6-diphenylphenyl)boronic acid is sourced from PubChem (CID 178131684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).