C20H19BO2 — CID 178131684
(3,5-dimethyl-2,6-diphenylphenyl)boronic acid (PubChem CID 178131684) has the molecular formula C20H19BO2 and a molecular weight of 302.18 g/mol. Its IUPAC name is (3,5-dimethyl-2,6-diphenylphenyl)boronic acid.
| Compound Name | (3,5-dimethyl-2,6-diphenylphenyl)boronic acid |
|---|---|
| PubChem CID | 178131684 |
| Molecular Formula | C20H19BO2 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3,5-dimethyl-2,6-diphenylphenyl)boronic acid |
| SMILES | Cc1cc(C)c(-c2ccccc2)c(B(O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C20H19BO2/c1-14-13-15(2)19(17-11-7-4-8-12-17)20(21(22)23)18(14)16-9-5-3-6-10-16/h3-13,22-23H,1-2H3 |
| InChIKey | JZGCREIQQABDIF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|