C18H23BO2 — CID 155616354
[4-phenyl-2,6-di(propan-2-yl)phenyl]boronic acid (PubChem CID 155616354) has the molecular formula C18H23BO2 and a molecular weight of 282.19 g/mol. Its IUPAC name is [4-phenyl-2,6-di(propan-2-yl)phenyl]boronic acid.
| Compound Name | [4-phenyl-2,6-di(propan-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 155616354 |
| Molecular Formula | C18H23BO2 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [4-phenyl-2,6-di(propan-2-yl)phenyl]boronic acid |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1B(O)O |
| InChI | InChI=1S/C18H23BO2/c1-12(2)16-10-15(14-8-6-5-7-9-14)11-17(13(3)4)18(16)19(20)21/h5-13,20-21H,1-4H3 |
| InChIKey | AQQZWMKSRPTZTQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|