C19H21N — CID 139123948
2-isocyano-5-phenyl-1,3-di(propan-2-yl)benzene (PubChem CID 139123948) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-isocyano-5-phenyl-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-isocyano-5-phenyl-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 139123948 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-isocyano-5-phenyl-1,3-di(propan-2-yl)benzene |
| SMILES | [C-]#[N+]c1c(C(C)C)cc(-c2ccccc2)cc1C(C)C |
| InChI | InChI=1S/C19H21N/c1-13(2)17-11-16(15-9-7-6-8-10-15)12-18(14(3)4)19(17)20-5/h6-14H,1-4H3 |
| InChIKey | AVVZEPNFYMYNJT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|