C19H24 — CID 140720985
2-methyl-5-phenyl-1,3-di(propan-2-yl)benzene (PubChem CID 140720985) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-methyl-5-phenyl-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-methyl-5-phenyl-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 140720985 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2-methyl-5-phenyl-1,3-di(propan-2-yl)benzene |
| SMILES | Cc1c(C(C)C)cc(-c2ccccc2)cc1C(C)C |
| InChI | InChI=1S/C19H24/c1-13(2)18-11-17(16-9-7-6-8-10-16)12-19(14(3)4)15(18)5/h6-14H,1-5H3 |
| InChIKey | SRHCYIZITLTNAK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |