C30H27N — CID 100959252
2-isocyano-5-[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]ethynyl]-1,3-di(propan-2-yl)benzene (PubChem CID 100959252) has the molecular formula C30H27N and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-isocyano-5-[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]ethynyl]-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-isocyano-5-[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]ethynyl]-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 100959252 |
| Molecular Formula | C30H27N |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 2-isocyano-5-[2-[4-[2-(4-methylphenyl)ethynyl]phenyl]ethynyl]-1,3-di(propan-2-yl)benzene |
| SMILES | [C-]#[N+]c1c(C(C)C)cc(C#Cc2ccc(C#Cc3ccc(C)cc3)cc2)cc1C(C)C |
| InChI | InChI=1S/C30H27N/c1-21(2)28-19-27(20-29(22(3)4)30(28)31-6)18-17-26-15-13-25(14-16-26)12-11-24-9-7-23(5)8-10-24/h7-10,13-16,19-22H,1-5H3 |
| InChIKey | HBJVLVAVURGBGL-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|