C17H15MoN+ — CID 20609326
[2,6-dimethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]azaniumylidynemolybdenum (PubChem CID 20609326) has the molecular formula C17H15MoN+ and a molecular weight of 329.25 g/mol. Its IUPAC name is [2,6-dimethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]azaniumylidynemolybdenum.
| Compound Name | [2,6-dimethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]azaniumylidynemolybdenum |
|---|---|
| PubChem CID | 20609326 |
| Molecular Formula | C17H15MoN+ |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | [2,6-dimethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]azaniumylidynemolybdenum |
| SMILES | Cc1ccc(C#Cc2cc(C)c([N+]#[Mo])c(C)c2)cc1 |
| InChI | InChI=1S/C17H15N.Mo/c1-12-4-6-15(7-5-12)8-9-16-10-13(2)17(18)14(3)11-16;/h4-7,10-11H,1-3H3;/q+1; |
| InChIKey | BZGQOLPKUCMOLR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|