C24H29MoN+ — CID 20609333
[4-[2-(3,5-ditert-butylphenyl)ethynyl]-2,6-dimethylphenyl]azaniumylidynemolybdenum (PubChem CID 20609333) has the molecular formula C24H29MoN+ and a molecular weight of 427.44 g/mol. Its IUPAC name is [4-[2-(3,5-ditert-butylphenyl)ethynyl]-2,6-dimethylphenyl]azaniumylidynemolybdenum.
| Compound Name | [4-[2-(3,5-ditert-butylphenyl)ethynyl]-2,6-dimethylphenyl]azaniumylidynemolybdenum |
|---|---|
| PubChem CID | 20609333 |
| Molecular Formula | C24H29MoN+ |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [4-[2-(3,5-ditert-butylphenyl)ethynyl]-2,6-dimethylphenyl]azaniumylidynemolybdenum |
| SMILES | Cc1cc(C#Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C)c1[N+]#[Mo] |
| InChI | InChI=1S/C24H29N.Mo/c1-16-11-18(12-17(2)22(16)25)9-10-19-13-20(23(3,4)5)15-21(14-19)24(6,7)8;/h11-15H,1-8H3;/q+1; |
| InChIKey | QMXWRILDXJTUBB-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|