About 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene
5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene (PubChem CID 116964832) has the molecular formula C13H17F3
and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene |
| PubChem CID | 116964832 |
| Molecular Formula | C13H17F3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(F)(F)F |
| InChI | InChI=1S/C13H17F3/c1-8-6-10(12(3,4)5)7-9(2)11(8)13(14,15)16/h6-7H,1-5H3 |
| InChIKey | LBTVGUGUNDCWBD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene?
The IUPAC name of 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene (CID 116964832) is 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene.
What is the SMILES notation for 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene?
The canonical SMILES for 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene is Cc1cc(C(C)(C)C)cc(C)c1C(F)(F)F.
What is the InChIKey of 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene?
The InChIKey is LBTVGUGUNDCWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3/c1-8-6-10(12(3,4)5)7-9(2)11(8)13(14,15)16/h6-7H,1-5H3.
What are the key properties of 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene?
5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene has a molecular weight of 230.27 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,3-dimethyl-2-(trifluoromethyl)benzene is sourced from PubChem (CID 116964832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).