About 1,4-ditert-butylbenzene
1,4-ditert-butylbenzene (PubChem CID 13895) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 1,4-ditert-butylbenzene.
Molecular Properties
| Compound Name | 1,4-ditert-butylbenzene |
| PubChem CID | 13895 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1,4-ditert-butylbenzene |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H22/c1-13(2,3)11-7-9-12(10-8-11)14(4,5)6/h7-10H,1-6H3 |
| InChIKey | OOWNNCMFKFBNOF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-ditert-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butylbenzene?
The IUPAC name of 1,4-ditert-butylbenzene (CID 13895) is 1,4-ditert-butylbenzene.
What is the SMILES notation for 1,4-ditert-butylbenzene?
The canonical SMILES for 1,4-ditert-butylbenzene is CC(C)(C)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1,4-ditert-butylbenzene?
The InChIKey is OOWNNCMFKFBNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-13(2,3)11-7-9-12(10-8-11)14(4,5)6/h7-10H,1-6H3.
What are the key properties of 1,4-ditert-butylbenzene?
1,4-ditert-butylbenzene has a molecular weight of 190.33 g/mol, XLogP of 4.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butylbenzene is sourced from PubChem (CID 13895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).