C40H46O2 — CID 11512413
4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]phthalaldehyde (PubChem CID 11512413) has the molecular formula C40H46O2 and a molecular weight of 558.81 g/mol. Its IUPAC name is 4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]phthalaldehyde.
| Compound Name | 4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]phthalaldehyde |
|---|---|
| PubChem CID | 11512413 |
| Molecular Formula | C40H46O2 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | 4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]phthalaldehyde |
| SMILES | CC(C)(C)c1cc(C#Cc2cc(C=O)c(C=O)cc2C#Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H46O2/c1-37(2,3)33-17-27(18-34(23-33)38(4,5)6)13-15-29-21-31(25-41)32(26-42)22-30(29)16-14-28-19-35(39(7,8)9)24-36(20-28)40(10,11)12/h17-26H,1-12H3 |
| InChIKey | CGTYZISKYQYFAB-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|