C56H57N3O — CID 11434253
4-[2-[4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]-2-methoxyphenyl]ethynyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 11434253) has the molecular formula C56H57N3O and a molecular weight of 788.09 g/mol. Its IUPAC name is 4-[2-[4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]-2-methoxyphenyl]ethynyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[2-[4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]-2-methoxyphenyl]ethynyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 11434253 |
| Molecular Formula | C56H57N3O |
| Molecular Weight | 788.09 g/mol |
| Exact Mass | 787.45 |
| IUPAC Name | 4-[2-[4,5-bis[2-(3,5-ditert-butylphenyl)ethynyl]-2-methoxyphenyl]ethynyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | COc1cc(C#Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(C#Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1C#Cc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C56H57N3O/c1-53(2,3)44-28-38(29-45(36-44)54(4,5)6)20-23-41-34-43(25-22-40-32-50(48-18-14-16-26-57-48)59-51(33-40)49-19-15-17-27-58-49)52(60-13)35-42(41)24-21-39-30-46(55(7,8)9)37-47(31-39)56(10,11)12/h14-19,26-37H,1-13H3 |
| InChIKey | FRUILFQJOSIWHH-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.09 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|