C17H11N3 — CID 10611160
4-ethynyl-2,6-dipyridin-2-ylpyridine (PubChem CID 10611160) has the molecular formula C17H11N3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 4-ethynyl-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-ethynyl-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 10611160 |
| Molecular Formula | C17H11N3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-ethynyl-2,6-dipyridin-2-ylpyridine |
| SMILES | C#Cc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C17H11N3/c1-2-13-11-16(14-7-3-5-9-18-14)20-17(12-13)15-8-4-6-10-19-15/h1,3-12H |
| InChIKey | ZZANNDBAWDILOJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|