C23H17N5O2 — CID 24752664
2,4-dimethoxy-6-[2-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)ethynyl]-1,3,5-triazine (PubChem CID 24752664) has the molecular formula C23H17N5O2 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2,4-dimethoxy-6-[2-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)ethynyl]-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-[2-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)ethynyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 24752664 |
| Molecular Formula | C23H17N5O2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2,4-dimethoxy-6-[2-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)ethynyl]-1,3,5-triazine |
| SMILES | COc1nc(C#Cc2cc(-c3ccccc3)nc(-c3ccccn3)c2)nc(OC)n1 |
| InChI | InChI=1S/C23H17N5O2/c1-29-22-26-21(27-23(28-22)30-2)12-11-16-14-19(17-8-4-3-5-9-17)25-20(15-16)18-10-6-7-13-24-18/h3-10,13-15H,1-2H3 |
| InChIKey | WPHRQCLUAJSBEK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|