C25H18N2 — CID 24750510
4-[2-(4-methylphenyl)ethynyl]-2-phenyl-6-pyridin-2-ylpyridine (PubChem CID 24750510) has the molecular formula C25H18N2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[2-(4-methylphenyl)ethynyl]-2-phenyl-6-pyridin-2-ylpyridine.
| Compound Name | 4-[2-(4-methylphenyl)ethynyl]-2-phenyl-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 24750510 |
| Molecular Formula | C25H18N2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-[2-(4-methylphenyl)ethynyl]-2-phenyl-6-pyridin-2-ylpyridine |
| SMILES | Cc1ccc(C#Cc2cc(-c3ccccc3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C25H18N2/c1-19-10-12-20(13-11-19)14-15-21-17-24(22-7-3-2-4-8-22)27-25(18-21)23-9-5-6-16-26-23/h2-13,16-18H,1H3 |
| InChIKey | RIIMCTQPCCILFS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|