C52H32N6 — CID 102407209
4-[3-[2-[4-[2-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 102407209) has the molecular formula C52H32N6 and a molecular weight of 740.87 g/mol. Its IUPAC name is 4-[3-[2-[4-[2-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[3-[2-[4-[2-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102407209 |
| Molecular Formula | C52H32N6 |
| Molecular Weight | 740.87 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 4-[3-[2-[4-[2-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | C(#Cc1cccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c1)c1ccc(C#Cc2cccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)c2)cc1 |
| InChI | InChI=1S/C52H32N6/c1-5-27-53-45(15-1)49-33-43(34-50(57-49)46-16-2-6-28-54-46)41-13-9-11-39(31-41)25-23-37-19-21-38(22-20-37)24-26-40-12-10-14-42(32-40)44-35-51(47-17-3-7-29-55-47)58-52(36-44)48-18-4-8-30-56-48/h1-22,27-36H |
| InChIKey | KBYMXHSDVFZEPK-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.87 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|