C46H42O2 — CID 102319621
4-[(E)-2-[2,5-bis[2-(4-tert-butylphenyl)ethynyl]-4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol (PubChem CID 102319621) has the molecular formula C46H42O2 and a molecular weight of 626.84 g/mol. Its IUPAC name is 4-[(E)-2-[2,5-bis[2-(4-tert-butylphenyl)ethynyl]-4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol.
| Compound Name | 4-[(E)-2-[2,5-bis[2-(4-tert-butylphenyl)ethynyl]-4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 102319621 |
| Molecular Formula | C46H42O2 |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | 4-[(E)-2-[2,5-bis[2-(4-tert-butylphenyl)ethynyl]-4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol |
| SMILES | CC(C)(C)c1ccc(C#Cc2cc(/C=C/c3ccc(O)cc3)c(C#Cc3ccc(C(C)(C)C)cc3)cc2/C=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C46H42O2/c1-45(2,3)41-23-11-33(12-24-41)7-19-37-31-40(22-10-36-17-29-44(48)30-18-36)38(20-8-34-13-25-42(26-14-34)46(4,5)6)32-39(37)21-9-35-15-27-43(47)28-16-35/h9-18,21-32,47-48H,1-6H3/b21-9+,22-10+ |
| InChIKey | VAAANKJWVJQWIZ-VGENTYGXSA-N |
| XLogP | 10.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|