C30H31BO2 — CID 86087482
[3,5-bis[2-(4-tert-butylphenyl)ethynyl]phenyl]boronic acid (PubChem CID 86087482) has the molecular formula C30H31BO2 and a molecular weight of 434.39 g/mol. Its IUPAC name is [3,5-bis[2-(4-tert-butylphenyl)ethynyl]phenyl]boronic acid.
| Compound Name | [3,5-bis[2-(4-tert-butylphenyl)ethynyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 86087482 |
| Molecular Formula | C30H31BO2 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | [3,5-bis[2-(4-tert-butylphenyl)ethynyl]phenyl]boronic acid |
| SMILES | CC(C)(C)c1ccc(C#Cc2cc(C#Cc3ccc(C(C)(C)C)cc3)cc(B(O)O)c2)cc1 |
| InChI | InChI=1S/C30H31BO2/c1-29(2,3)26-15-11-22(12-16-26)7-9-24-19-25(21-28(20-24)31(32)33)10-8-23-13-17-27(18-14-23)30(4,5)6/h11-21,32-33H,1-6H3 |
| InChIKey | MDMYZRUWSNNCCO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|